C19H22ClFN3O3+ — CID 9025808
[2-(5-chloro-2-fluoroanilino)-2-oxoethyl]-ethyl-[2-(3-methoxyanilino)-2-oxoethyl]azanium (PubChem CID 9025808) has the molecular formula C19H22ClFN3O3+ and a molecular weight of 394.85 g/mol. Its IUPAC name is [2-(5-chloro-2-fluoroanilino)-2-oxoethyl]-ethyl-[2-(3-methoxyanilino)-2-oxoethyl]azanium.
| Compound Name | [2-(5-chloro-2-fluoroanilino)-2-oxoethyl]-ethyl-[2-(3-methoxyanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9025808 |
| Molecular Formula | C19H22ClFN3O3+ |
| Molecular Weight | 394.85 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | [2-(5-chloro-2-fluoroanilino)-2-oxoethyl]-ethyl-[2-(3-methoxyanilino)-2-oxoethyl]azanium |
| SMILES | CC[NH+](CC(=O)Nc1cccc(OC)c1)CC(=O)Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C19H21ClFN3O3/c1-3-24(11-18(25)22-14-5-4-6-15(10-14)27-2)12-19(26)23-17-9-13(20)7-8-16(17)21/h4-10H,3,11-12H2,1-2H3,(H,22,25)(H,23,26)/p+1 |
| InChIKey | QJMMBEUZXQRCPH-UHFFFAOYSA-O |
| XLogP | 1.97 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.85 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |