C18H22N2O5S — CID 22300310
2-[(4-ethoxyphenyl)methylsulfonylamino]-N-(3-methoxyphenyl)acetamide (PubChem CID 22300310) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is 2-[(4-ethoxyphenyl)methylsulfonylamino]-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[(4-ethoxyphenyl)methylsulfonylamino]-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 22300310 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2-[(4-ethoxyphenyl)methylsulfonylamino]-N-(3-methoxyphenyl)acetamide |
| SMILES | CCOc1ccc(CS(=O)(=O)NCC(=O)Nc2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C18H22N2O5S/c1-3-25-16-9-7-14(8-10-16)13-26(22,23)19-12-18(21)20-15-5-4-6-17(11-15)24-2/h4-11,19H,3,12-13H2,1-2H3,(H,20,21) |
| InChIKey | JKQMZULNXSKAEJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |