C20H25N4O4+ — CID 8025166
[2-(4-carbamoylanilino)-2-oxoethyl]-ethyl-[2-(2-methoxyanilino)-2-oxoethyl]azanium (PubChem CID 8025166) has the molecular formula C20H25N4O4+ and a molecular weight of 385.44 g/mol. Its IUPAC name is [2-(4-carbamoylanilino)-2-oxoethyl]-ethyl-[2-(2-methoxyanilino)-2-oxoethyl]azanium.
| Compound Name | [2-(4-carbamoylanilino)-2-oxoethyl]-ethyl-[2-(2-methoxyanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8025166 |
| Molecular Formula | C20H25N4O4+ |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | [2-(4-carbamoylanilino)-2-oxoethyl]-ethyl-[2-(2-methoxyanilino)-2-oxoethyl]azanium |
| SMILES | CC[NH+](CC(=O)Nc1ccc(C(N)=O)cc1)CC(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C20H24N4O4/c1-3-24(13-19(26)23-16-6-4-5-7-17(16)28-2)12-18(25)22-15-10-8-14(9-11-15)20(21)27/h4-11H,3,12-13H2,1-2H3,(H2,21,27)(H,22,25)(H,23,26)/p+1 |
| InChIKey | QTYNYVZAQVQBBU-UHFFFAOYSA-O |
| XLogP | 0.28 |
| TPSA | 114.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |