C13H21N2O2+ — CID 7447498
diethyl-[2-(2-methoxyanilino)-2-oxoethyl]azanium (PubChem CID 7447498) has the molecular formula C13H21N2O2+ and a molecular weight of 237.32 g/mol. Its IUPAC name is diethyl-[2-(2-methoxyanilino)-2-oxoethyl]azanium.
| Compound Name | diethyl-[2-(2-methoxyanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 7447498 |
| Molecular Formula | C13H21N2O2+ |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | diethyl-[2-(2-methoxyanilino)-2-oxoethyl]azanium |
| SMILES | CC[NH+](CC)CC(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C13H20N2O2/c1-4-15(5-2)10-13(16)14-11-8-6-7-9-12(11)17-3/h6-9H,4-5,10H2,1-3H3,(H,14,16)/p+1 |
| InChIKey | MULDTYNOXOMLNF-UHFFFAOYSA-O |
| XLogP | 0.56 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |