C21H27N4O5+ — CID 8709472
[2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]-ethyl-[2-(2-methoxyanilino)-2-oxoethyl]azanium (PubChem CID 8709472) has the molecular formula C21H27N4O5+ and a molecular weight of 415.47 g/mol. Its IUPAC name is [2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]-ethyl-[2-(2-methoxyanilino)-2-oxoethyl]azanium.
| Compound Name | [2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]-ethyl-[2-(2-methoxyanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8709472 |
| Molecular Formula | C21H27N4O5+ |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | [2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]-ethyl-[2-(2-methoxyanilino)-2-oxoethyl]azanium |
| SMILES | CC[NH+](CC(=O)Nc1ccccc1OC)CC(=O)Nc1c([N+](=O)[O-])ccc(C)c1C |
| InChI | InChI=1S/C21H26N4O5/c1-5-24(12-19(26)22-16-8-6-7-9-18(16)30-4)13-20(27)23-21-15(3)14(2)10-11-17(21)25(28)29/h6-11H,5,12-13H2,1-4H3,(H,22,26)(H,23,27)/p+1 |
| InChIKey | BXWQKAGVCWTOFL-UHFFFAOYSA-O |
| XLogP | 1.70 |
| TPSA | 115.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|