C20H26N3O5+ — CID 8709146
(2,3-dimethoxyphenyl)methyl-[2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]-methylazanium (PubChem CID 8709146) has the molecular formula C20H26N3O5+ and a molecular weight of 388.44 g/mol. Its IUPAC name is (2,3-dimethoxyphenyl)methyl-[2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]-methylazanium.
| Compound Name | (2,3-dimethoxyphenyl)methyl-[2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8709146 |
| Molecular Formula | C20H26N3O5+ |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | (2,3-dimethoxyphenyl)methyl-[2-(2,3-dimethyl-6-nitroanilino)-2-oxoethyl]-methylazanium |
| SMILES | COc1cccc(C[NH+](C)CC(=O)Nc2c([N+](=O)[O-])ccc(C)c2C)c1OC |
| InChI | InChI=1S/C20H25N3O5/c1-13-9-10-16(23(25)26)19(14(13)2)21-18(24)12-22(3)11-15-7-6-8-17(27-4)20(15)28-5/h6-10H,11-12H2,1-5H3,(H,21,24)/p+1 |
| InChIKey | WQROTSXFDTVINY-UHFFFAOYSA-O |
| XLogP | 1.88 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|