C19H24N3O6+ — CID 9196682
(2,3-dimethoxyphenyl)methyl-[2-(2-methoxy-4-nitroanilino)-2-oxoethyl]-methylazanium (PubChem CID 9196682) has the molecular formula C19H24N3O6+ and a molecular weight of 390.42 g/mol. Its IUPAC name is (2,3-dimethoxyphenyl)methyl-[2-(2-methoxy-4-nitroanilino)-2-oxoethyl]-methylazanium.
| Compound Name | (2,3-dimethoxyphenyl)methyl-[2-(2-methoxy-4-nitroanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9196682 |
| Molecular Formula | C19H24N3O6+ |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (2,3-dimethoxyphenyl)methyl-[2-(2-methoxy-4-nitroanilino)-2-oxoethyl]-methylazanium |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)C[NH+](C)Cc1cccc(OC)c1OC |
| InChI | InChI=1S/C19H23N3O6/c1-21(11-13-6-5-7-16(26-2)19(13)28-4)12-18(23)20-15-9-8-14(22(24)25)10-17(15)27-3/h5-10H,11-12H2,1-4H3,(H,20,23)/p+1 |
| InChIKey | OIORGTLWHNLPNQ-UHFFFAOYSA-O |
| XLogP | 1.27 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|