C17H21ClN3O3+ — CID 8709121
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-[(2,3-dimethoxyphenyl)methyl]-methylazanium (PubChem CID 8709121) has the molecular formula C17H21ClN3O3+ and a molecular weight of 350.83 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-[(2,3-dimethoxyphenyl)methyl]-methylazanium.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-[(2,3-dimethoxyphenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 8709121 |
| Molecular Formula | C17H21ClN3O3+ |
| Molecular Weight | 350.83 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-[(2,3-dimethoxyphenyl)methyl]-methylazanium |
| SMILES | COc1cccc(C[NH+](C)CC(=O)Nc2cccnc2Cl)c1OC |
| InChI | InChI=1S/C17H20ClN3O3/c1-21(10-12-6-4-8-14(23-2)16(12)24-3)11-15(22)20-13-7-5-9-19-17(13)18/h4-9H,10-11H2,1-3H3,(H,20,22)/p+1 |
| InChIKey | DHUYGWOMCCKKBD-UHFFFAOYSA-O |
| XLogP | 1.41 |
| TPSA | 64.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.83 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|