C18H22ClN4O2+ — CID 8710007
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-[2-(2,3-dimethylanilino)-2-oxoethyl]-methylazanium (PubChem CID 8710007) has the molecular formula C18H22ClN4O2+ and a molecular weight of 361.85 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-[2-(2,3-dimethylanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-[2-(2,3-dimethylanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8710007 |
| Molecular Formula | C18H22ClN4O2+ |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-[2-(2,3-dimethylanilino)-2-oxoethyl]-methylazanium |
| SMILES | Cc1cccc(NC(=O)C[NH+](C)CC(=O)Nc2cccnc2Cl)c1C |
| InChI | InChI=1S/C18H21ClN4O2/c1-12-6-4-7-14(13(12)2)21-16(24)10-23(3)11-17(25)22-15-8-5-9-20-18(15)19/h4-9H,10-11H2,1-3H3,(H,21,24)(H,22,25)/p+1 |
| InChIKey | KVBNTAALCJJNMK-UHFFFAOYSA-O |
| XLogP | 1.44 |
| TPSA | 75.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|