C19H21F3N3O2+ — CID 2657991
[2-(2,3-dimethylanilino)-2-oxoethyl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium (PubChem CID 2657991) has the molecular formula C19H21F3N3O2+ and a molecular weight of 380.39 g/mol. Its IUPAC name is [2-(2,3-dimethylanilino)-2-oxoethyl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium.
| Compound Name | [2-(2,3-dimethylanilino)-2-oxoethyl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
|---|---|
| PubChem CID | 2657991 |
| Molecular Formula | C19H21F3N3O2+ |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | [2-(2,3-dimethylanilino)-2-oxoethyl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
| SMILES | Cc1cccc(NC(=O)C[NH+](C)CC(=O)Nc2ccc(F)c(F)c2F)c1C |
| InChI | InChI=1S/C19H20F3N3O2/c1-11-5-4-6-14(12(11)2)23-16(26)9-25(3)10-17(27)24-15-8-7-13(20)18(21)19(15)22/h4-8H,9-10H2,1-3H3,(H,23,26)(H,24,27)/p+1 |
| InChIKey | ARIYLSXXWHVXQF-UHFFFAOYSA-O |
| XLogP | 1.81 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|