C19H19F3N3O3+ — CID 9197745
[2-(3-acetylanilino)-2-oxoethyl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium (PubChem CID 9197745) has the molecular formula C19H19F3N3O3+ and a molecular weight of 394.37 g/mol. Its IUPAC name is [2-(3-acetylanilino)-2-oxoethyl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium.
| Compound Name | [2-(3-acetylanilino)-2-oxoethyl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
|---|---|
| PubChem CID | 9197745 |
| Molecular Formula | C19H19F3N3O3+ |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | [2-(3-acetylanilino)-2-oxoethyl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
| SMILES | CC(=O)c1cccc(NC(=O)C[NH+](C)CC(=O)Nc2ccc(F)c(F)c2F)c1 |
| InChI | InChI=1S/C19H18F3N3O3/c1-11(26)12-4-3-5-13(8-12)23-16(27)9-25(2)10-17(28)24-15-7-6-14(20)18(21)19(15)22/h3-8H,9-10H2,1-2H3,(H,23,27)(H,24,28)/p+1 |
| InChIKey | PVZNZNNVMUUZRR-UHFFFAOYSA-O |
| XLogP | 1.40 |
| TPSA | 79.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|