C15H21F3N3O2+ — CID 9197933
[2-[[(2R)-butan-2-yl]amino]-2-oxoethyl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium (PubChem CID 9197933) has the molecular formula C15H21F3N3O2+ and a molecular weight of 332.35 g/mol. Its IUPAC name is [2-[[(2R)-butan-2-yl]amino]-2-oxoethyl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium.
| Compound Name | [2-[[(2R)-butan-2-yl]amino]-2-oxoethyl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
|---|---|
| PubChem CID | 9197933 |
| Molecular Formula | C15H21F3N3O2+ |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | [2-[[(2R)-butan-2-yl]amino]-2-oxoethyl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
| SMILES | CC[C@@H](C)NC(=O)C[NH+](C)CC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H20F3N3O2/c1-4-9(2)19-12(22)7-21(3)8-13(23)20-11-6-5-10(16)14(17)15(11)18/h5-6,9H,4,7-8H2,1-3H3,(H,19,22)(H,20,23)/p+1/t9-/m1/s1 |
| InChIKey | OKSNLQQZKQNEDK-SECBINFHSA-O |
| XLogP | 0.47 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|