C22H27F3N3O2+ — CID 8709925
methyl-[2-[[(1S)-3-methyl-1-phenylbutyl]amino]-2-oxoethyl]-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium (PubChem CID 8709925) has the molecular formula C22H27F3N3O2+ and a molecular weight of 422.47 g/mol. Its IUPAC name is methyl-[2-[[(1S)-3-methyl-1-phenylbutyl]amino]-2-oxoethyl]-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium.
| Compound Name | methyl-[2-[[(1S)-3-methyl-1-phenylbutyl]amino]-2-oxoethyl]-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
|---|---|
| PubChem CID | 8709925 |
| Molecular Formula | C22H27F3N3O2+ |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | methyl-[2-[[(1S)-3-methyl-1-phenylbutyl]amino]-2-oxoethyl]-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
| SMILES | CC(C)C[C@H](NC(=O)C[NH+](C)CC(=O)Nc1ccc(F)c(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C22H26F3N3O2/c1-14(2)11-18(15-7-5-4-6-8-15)27-20(30)13-28(3)12-19(29)26-17-10-9-16(23)21(24)22(17)25/h4-10,14,18H,11-13H2,1-3H3,(H,26,29)(H,27,30)/p+1/t18-/m0/s1 |
| InChIKey | RRPYULXIRODGPZ-SFHVURJKSA-O |
| XLogP | 2.46 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|