C17H18F3N2O2+ — CID 9197464
methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-(2-phenoxyethyl)azanium (PubChem CID 9197464) has the molecular formula C17H18F3N2O2+ and a molecular weight of 339.34 g/mol. Its IUPAC name is methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-(2-phenoxyethyl)azanium.
| Compound Name | methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-(2-phenoxyethyl)azanium |
|---|---|
| PubChem CID | 9197464 |
| Molecular Formula | C17H18F3N2O2+ |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-(2-phenoxyethyl)azanium |
| SMILES | C[NH+](CCOc1ccccc1)CC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H17F3N2O2/c1-22(9-10-24-12-5-3-2-4-6-12)11-15(23)21-14-8-7-13(18)16(19)17(14)20/h2-8H,9-11H2,1H3,(H,21,23)/p+1 |
| InChIKey | XVOYCFQHBCRXTN-UHFFFAOYSA-O |
| XLogP | 1.64 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|