C18H19ClF3N2O2+ — CID 9252465
2-(4-chlorophenoxy)ethyl-methyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]azanium (PubChem CID 9252465) has the molecular formula C18H19ClF3N2O2+ and a molecular weight of 387.81 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)ethyl-methyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]azanium.
| Compound Name | 2-(4-chlorophenoxy)ethyl-methyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]azanium |
|---|---|
| PubChem CID | 9252465 |
| Molecular Formula | C18H19ClF3N2O2+ |
| Molecular Weight | 387.81 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 2-(4-chlorophenoxy)ethyl-methyl-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]azanium |
| SMILES | C[NH+](CCOc1ccc(Cl)cc1)CC(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H18ClF3N2O2/c1-24(10-11-26-14-8-6-13(19)7-9-14)12-17(25)23-16-5-3-2-4-15(16)18(20,21)22/h2-9H,10-12H2,1H3,(H,23,25)/p+1 |
| InChIKey | WPJFQUJQKMCSAH-UHFFFAOYSA-O |
| XLogP | 2.89 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.81 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |