C18H17ClF3NO2S — CID 26632928
(2S)-2-[2-(4-chlorophenoxy)ethylsulfanyl]-N-[2-(trifluoromethyl)phenyl]propanamide (PubChem CID 26632928) has the molecular formula C18H17ClF3NO2S and a molecular weight of 403.85 g/mol. Its IUPAC name is (2S)-2-[2-(4-chlorophenoxy)ethylsulfanyl]-N-[2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (2S)-2-[2-(4-chlorophenoxy)ethylsulfanyl]-N-[2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 26632928 |
| Molecular Formula | C18H17ClF3NO2S |
| Molecular Weight | 403.85 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | (2S)-2-[2-(4-chlorophenoxy)ethylsulfanyl]-N-[2-(trifluoromethyl)phenyl]propanamide |
| SMILES | C[C@H](SCCOc1ccc(Cl)cc1)C(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H17ClF3NO2S/c1-12(26-11-10-25-14-8-6-13(19)7-9-14)17(24)23-16-5-3-2-4-15(16)18(20,21)22/h2-9,12H,10-11H2,1H3,(H,23,24)/t12-/m0/s1 |
| InChIKey | KEKUBVWEJZPAQK-LBPRGKRZSA-N |
| XLogP | 5.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.85 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|