C19H19ClN2O2S — CID 46634146
N-(3-chloro-2-methylphenyl)-2-[2-(4-cyanophenoxy)ethylsulfanyl]propanamide (PubChem CID 46634146) has the molecular formula C19H19ClN2O2S and a molecular weight of 374.89 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-2-[2-(4-cyanophenoxy)ethylsulfanyl]propanamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-2-[2-(4-cyanophenoxy)ethylsulfanyl]propanamide |
|---|---|
| PubChem CID | 46634146 |
| Molecular Formula | C19H19ClN2O2S |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-2-[2-(4-cyanophenoxy)ethylsulfanyl]propanamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)C(C)SCCOc1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H19ClN2O2S/c1-13-17(20)4-3-5-18(13)22-19(23)14(2)25-11-10-24-16-8-6-15(12-21)7-9-16/h3-9,14H,10-11H2,1-2H3,(H,22,23) |
| InChIKey | XMOOMDRIDDDKGW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|