C17H17BrClNOS — CID 47011598
2-[(3-bromophenyl)methylsulfanyl]-N-(3-chloro-2-methylphenyl)propanamide (PubChem CID 47011598) has the molecular formula C17H17BrClNOS and a molecular weight of 398.75 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methylsulfanyl]-N-(3-chloro-2-methylphenyl)propanamide.
| Compound Name | 2-[(3-bromophenyl)methylsulfanyl]-N-(3-chloro-2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 47011598 |
| Molecular Formula | C17H17BrClNOS |
| Molecular Weight | 398.75 g/mol |
| Exact Mass | 396.99 |
| IUPAC Name | 2-[(3-bromophenyl)methylsulfanyl]-N-(3-chloro-2-methylphenyl)propanamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)C(C)SCc1cccc(Br)c1 |
| InChI | InChI=1S/C17H17BrClNOS/c1-11-15(19)7-4-8-16(11)20-17(21)12(2)22-10-13-5-3-6-14(18)9-13/h3-9,12H,10H2,1-2H3,(H,20,21) |
| InChIKey | WCEXVAFVRKXVSV-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.75 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |