C18H20BrNOS — CID 8570825
(2R)-2-[(4-bromophenyl)methylsulfanyl]-N-(2-ethylphenyl)propanamide (PubChem CID 8570825) has the molecular formula C18H20BrNOS and a molecular weight of 378.34 g/mol. Its IUPAC name is (2R)-2-[(4-bromophenyl)methylsulfanyl]-N-(2-ethylphenyl)propanamide.
| Compound Name | (2R)-2-[(4-bromophenyl)methylsulfanyl]-N-(2-ethylphenyl)propanamide |
|---|---|
| PubChem CID | 8570825 |
| Molecular Formula | C18H20BrNOS |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | (2R)-2-[(4-bromophenyl)methylsulfanyl]-N-(2-ethylphenyl)propanamide |
| SMILES | CCc1ccccc1NC(=O)[C@@H](C)SCc1ccc(Br)cc1 |
| InChI | InChI=1S/C18H20BrNOS/c1-3-15-6-4-5-7-17(15)20-18(21)13(2)22-12-14-8-10-16(19)11-9-14/h4-11,13H,3,12H2,1-2H3,(H,20,21)/t13-/m1/s1 |
| InChIKey | UYWSRMWFNHHLAN-CYBMUJFWSA-N |
| XLogP | 5.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |