C18H18Cl3NO2S — CID 41259550
(2R)-2-[3-(4-chlorophenoxy)propylsulfanyl]-N-(2,6-dichlorophenyl)propanamide (PubChem CID 41259550) has the molecular formula C18H18Cl3NO2S and a molecular weight of 418.77 g/mol. Its IUPAC name is (2R)-2-[3-(4-chlorophenoxy)propylsulfanyl]-N-(2,6-dichlorophenyl)propanamide.
| Compound Name | (2R)-2-[3-(4-chlorophenoxy)propylsulfanyl]-N-(2,6-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 41259550 |
| Molecular Formula | C18H18Cl3NO2S |
| Molecular Weight | 418.77 g/mol |
| Exact Mass | 417.01 |
| IUPAC Name | (2R)-2-[3-(4-chlorophenoxy)propylsulfanyl]-N-(2,6-dichlorophenyl)propanamide |
| SMILES | C[C@@H](SCCCOc1ccc(Cl)cc1)C(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H18Cl3NO2S/c1-12(18(23)22-17-15(20)4-2-5-16(17)21)25-11-3-10-24-14-8-6-13(19)7-9-14/h2,4-9,12H,3,10-11H2,1H3,(H,22,23)/t12-/m1/s1 |
| InChIKey | JMEICHYCVUGTPA-GFCCVEGCSA-N |
| XLogP | 6.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.77 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|