C14H20Cl2N2OS — CID 107748565
N-(4-amino-2,6-dichlorophenyl)-2-pentylsulfanylpropanamide (PubChem CID 107748565) has the molecular formula C14H20Cl2N2OS and a molecular weight of 335.30 g/mol. Its IUPAC name is N-(4-amino-2,6-dichlorophenyl)-2-pentylsulfanylpropanamide.
| Compound Name | N-(4-amino-2,6-dichlorophenyl)-2-pentylsulfanylpropanamide |
|---|---|
| PubChem CID | 107748565 |
| Molecular Formula | C14H20Cl2N2OS |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | N-(4-amino-2,6-dichlorophenyl)-2-pentylsulfanylpropanamide |
| SMILES | CCCCCSC(C)C(=O)Nc1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C14H20Cl2N2OS/c1-3-4-5-6-20-9(2)14(19)18-13-11(15)7-10(17)8-12(13)16/h7-9H,3-6,17H2,1-2H3,(H,18,19) |
| InChIKey | RVNGFFJGOUAAPQ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|