C13H18Cl2N2O3 — CID 43093302
N-(4-amino-2,6-dichlorophenyl)-2-(2-ethoxyethoxy)propanamide (PubChem CID 43093302) has the molecular formula C13H18Cl2N2O3 and a molecular weight of 321.20 g/mol. Its IUPAC name is N-(4-amino-2,6-dichlorophenyl)-2-(2-ethoxyethoxy)propanamide.
| Compound Name | N-(4-amino-2,6-dichlorophenyl)-2-(2-ethoxyethoxy)propanamide |
|---|---|
| PubChem CID | 43093302 |
| Molecular Formula | C13H18Cl2N2O3 |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | N-(4-amino-2,6-dichlorophenyl)-2-(2-ethoxyethoxy)propanamide |
| SMILES | CCOCCOC(C)C(=O)Nc1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C13H18Cl2N2O3/c1-3-19-4-5-20-8(2)13(18)17-12-10(14)6-9(16)7-11(12)15/h6-8H,3-5,16H2,1-2H3,(H,17,18) |
| InChIKey | HQLUOKGBPKQELS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|