C11H12Cl2F2N2O2 — CID 82004014
N-(4-amino-2,6-dichlorophenyl)-2-(2,2-difluoroethoxy)propanamide (PubChem CID 82004014) has the molecular formula C11H12Cl2F2N2O2 and a molecular weight of 313.13 g/mol. Its IUPAC name is N-(4-amino-2,6-dichlorophenyl)-2-(2,2-difluoroethoxy)propanamide.
| Compound Name | N-(4-amino-2,6-dichlorophenyl)-2-(2,2-difluoroethoxy)propanamide |
|---|---|
| PubChem CID | 82004014 |
| Molecular Formula | C11H12Cl2F2N2O2 |
| Molecular Weight | 313.13 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | N-(4-amino-2,6-dichlorophenyl)-2-(2,2-difluoroethoxy)propanamide |
| SMILES | CC(OCC(F)F)C(=O)Nc1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C11H12Cl2F2N2O2/c1-5(19-4-9(14)15)11(18)17-10-7(12)2-6(16)3-8(10)13/h2-3,5,9H,4,16H2,1H3,(H,17,18) |
| InChIKey | BIQFWEBJGVDLBM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.13 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|