C13H20N3O3+ — CID 8555496
methyl-[2-(methylcarbamoylamino)-2-oxoethyl]-(2-phenoxyethyl)azanium (PubChem CID 8555496) has the molecular formula C13H20N3O3+ and a molecular weight of 266.32 g/mol. Its IUPAC name is methyl-[2-(methylcarbamoylamino)-2-oxoethyl]-(2-phenoxyethyl)azanium.
| Compound Name | methyl-[2-(methylcarbamoylamino)-2-oxoethyl]-(2-phenoxyethyl)azanium |
|---|---|
| PubChem CID | 8555496 |
| Molecular Formula | C13H20N3O3+ |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | methyl-[2-(methylcarbamoylamino)-2-oxoethyl]-(2-phenoxyethyl)azanium |
| SMILES | CNC(=O)NC(=O)C[NH+](C)CCOc1ccccc1 |
| InChI | InChI=1S/C13H19N3O3/c1-14-13(18)15-12(17)10-16(2)8-9-19-11-6-4-3-5-7-11/h3-7H,8-10H2,1-2H3,(H2,14,15,17,18)/p+1 |
| InChIKey | VBNVMQTXOVWIBF-UHFFFAOYSA-O |
| XLogP | -0.96 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |