C19H25N2O3+ — CID 8797883
[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]-methyl-(2-phenoxyethyl)azanium (PubChem CID 8797883) has the molecular formula C19H25N2O3+ and a molecular weight of 329.42 g/mol. Its IUPAC name is [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]-methyl-(2-phenoxyethyl)azanium.
| Compound Name | [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]-methyl-(2-phenoxyethyl)azanium |
|---|---|
| PubChem CID | 8797883 |
| Molecular Formula | C19H25N2O3+ |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | [2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]-methyl-(2-phenoxyethyl)azanium |
| SMILES | COc1ccc(CNC(=O)C[NH+](C)CCOc2ccccc2)cc1 |
| InChI | InChI=1S/C19H24N2O3/c1-21(12-13-24-18-6-4-3-5-7-18)15-19(22)20-14-16-8-10-17(23-2)11-9-16/h3-11H,12-15H2,1-2H3,(H,20,22)/p+1 |
| InChIKey | ZKGFDZIROYHLLY-UHFFFAOYSA-O |
| XLogP | 0.91 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |