C16H27N2O3+ — CID 8767256
[2-(tert-butylamino)-2-oxoethyl]-[2-(4-methoxyphenoxy)ethyl]-methylazanium (PubChem CID 8767256) has the molecular formula C16H27N2O3+ and a molecular weight of 295.40 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl]-[2-(4-methoxyphenoxy)ethyl]-methylazanium.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl]-[2-(4-methoxyphenoxy)ethyl]-methylazanium |
|---|---|
| PubChem CID | 8767256 |
| Molecular Formula | C16H27N2O3+ |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl]-[2-(4-methoxyphenoxy)ethyl]-methylazanium |
| SMILES | COc1ccc(OCC[NH+](C)CC(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H26N2O3/c1-16(2,3)17-15(19)12-18(4)10-11-21-14-8-6-13(20-5)7-9-14/h6-9H,10-12H2,1-5H3,(H,17,19)/p+1 |
| InChIKey | XMBFQJIJIUWPGX-UHFFFAOYSA-O |
| XLogP | 0.50 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |