C20H24F3N2O+ — CID 8645928
[(1S)-3-methyl-1-phenylbutyl]-[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]azanium (PubChem CID 8645928) has the molecular formula C20H24F3N2O+ and a molecular weight of 365.42 g/mol. Its IUPAC name is [(1S)-3-methyl-1-phenylbutyl]-[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]azanium.
| Compound Name | [(1S)-3-methyl-1-phenylbutyl]-[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]azanium |
|---|---|
| PubChem CID | 8645928 |
| Molecular Formula | C20H24F3N2O+ |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | [(1S)-3-methyl-1-phenylbutyl]-[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]azanium |
| SMILES | CC(C)C[C@H]([NH2+][C@@H](C)C(=O)Nc1ccc(F)c(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C20H23F3N2O/c1-12(2)11-17(14-7-5-4-6-8-14)24-13(3)20(26)25-16-10-9-15(21)18(22)19(16)23/h4-10,12-13,17,24H,11H2,1-3H3,(H,25,26)/p+1/t13-,17-/m0/s1 |
| InChIKey | HPYHYZUZEWNQCJ-GUYCJALGSA-O |
| XLogP | 3.78 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|