C20H18F3N2O2+ — CID 8755457
[(R)-furan-2-yl(phenyl)methyl]-[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]azanium (PubChem CID 8755457) has the molecular formula C20H18F3N2O2+ and a molecular weight of 375.37 g/mol. Its IUPAC name is [(R)-furan-2-yl(phenyl)methyl]-[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]azanium.
| Compound Name | [(R)-furan-2-yl(phenyl)methyl]-[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]azanium |
|---|---|
| PubChem CID | 8755457 |
| Molecular Formula | C20H18F3N2O2+ |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | [(R)-furan-2-yl(phenyl)methyl]-[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]azanium |
| SMILES | C[C@H]([NH2+][C@H](c1ccccc1)c1ccco1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H17F3N2O2/c1-12(20(26)25-15-10-9-14(21)17(22)18(15)23)24-19(16-8-5-11-27-16)13-6-3-2-4-7-13/h2-12,19,24H,1H3,(H,25,26)/p+1/t12-,19+/m0/s1 |
| InChIKey | BFPWVRTWZNCEJP-HXPMCKFVSA-O |
| XLogP | 3.38 |
| TPSA | 58.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|