C21H23N2O3+ — CID 8755577
[(S)-furan-2-yl(phenyl)methyl]-[(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl]azanium (PubChem CID 8755577) has the molecular formula C21H23N2O3+ and a molecular weight of 351.43 g/mol. Its IUPAC name is [(S)-furan-2-yl(phenyl)methyl]-[(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl]azanium.
| Compound Name | [(S)-furan-2-yl(phenyl)methyl]-[(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 8755577 |
| Molecular Formula | C21H23N2O3+ |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | [(S)-furan-2-yl(phenyl)methyl]-[(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl]azanium |
| SMILES | COc1ccccc1NC(=O)[C@H](C)[NH2+][C@@H](c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C21H22N2O3/c1-15(21(24)23-17-11-6-7-12-18(17)25-2)22-20(19-13-8-14-26-19)16-9-4-3-5-10-16/h3-15,20,22H,1-2H3,(H,23,24)/p+1/t15-,20-/m0/s1 |
| InChIKey | SNIYYVWIXYPHMC-YWZLYKJASA-O |
| XLogP | 2.97 |
| TPSA | 68.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |