C24H27N2O2+ — CID 9391931
[(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl]-[(R)-(4-methylphenyl)-phenylmethyl]azanium (PubChem CID 9391931) has the molecular formula C24H27N2O2+ and a molecular weight of 375.49 g/mol. Its IUPAC name is [(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl]-[(R)-(4-methylphenyl)-phenylmethyl]azanium.
| Compound Name | [(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl]-[(R)-(4-methylphenyl)-phenylmethyl]azanium |
|---|---|
| PubChem CID | 9391931 |
| Molecular Formula | C24H27N2O2+ |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | [(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl]-[(R)-(4-methylphenyl)-phenylmethyl]azanium |
| SMILES | COc1ccccc1NC(=O)[C@H](C)[NH2+][C@H](c1ccccc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H26N2O2/c1-17-13-15-20(16-14-17)23(19-9-5-4-6-10-19)25-18(2)24(27)26-21-11-7-8-12-22(21)28-3/h4-16,18,23,25H,1-3H3,(H,26,27)/p+1/t18-,23+/m0/s1 |
| InChIKey | KAZQYAMNVPBBLQ-FDDCHVKYSA-O |
| XLogP | 3.68 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |