C21H23N2O2S+ — CID 9051308
[(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl]-[(S)-phenyl(thiophen-2-yl)methyl]azanium (PubChem CID 9051308) has the molecular formula C21H23N2O2S+ and a molecular weight of 367.49 g/mol. Its IUPAC name is [(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl]-[(S)-phenyl(thiophen-2-yl)methyl]azanium.
| Compound Name | [(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl]-[(S)-phenyl(thiophen-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 9051308 |
| Molecular Formula | C21H23N2O2S+ |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | [(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl]-[(S)-phenyl(thiophen-2-yl)methyl]azanium |
| SMILES | COc1ccccc1NC(=O)[C@H](C)[NH2+][C@@H](c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C21H22N2O2S/c1-15(21(24)23-17-11-6-7-12-18(17)25-2)22-20(19-13-8-14-26-19)16-9-4-3-5-10-16/h3-15,20,22H,1-2H3,(H,23,24)/p+1/t15-,20-/m0/s1 |
| InChIKey | QJJVOICEACIJQI-YWZLYKJASA-O |
| XLogP | 3.44 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |