C19H25N2OS+ — CID 8863202
[(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl]-[(S)-phenyl(thiophen-2-yl)methyl]azanium (PubChem CID 8863202) has the molecular formula C19H25N2OS+ and a molecular weight of 329.49 g/mol. Its IUPAC name is [(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl]-[(S)-phenyl(thiophen-2-yl)methyl]azanium.
| Compound Name | [(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl]-[(S)-phenyl(thiophen-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 8863202 |
| Molecular Formula | C19H25N2OS+ |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | [(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl]-[(S)-phenyl(thiophen-2-yl)methyl]azanium |
| SMILES | C[C@H]([NH2+][C@@H](c1ccccc1)c1cccs1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C19H24N2OS/c1-14(19(22)21-16-10-5-6-11-16)20-18(17-12-7-13-23-17)15-8-3-2-4-9-15/h2-4,7-9,12-14,16,18,20H,5-6,10-11H2,1H3,(H,21,22)/p+1/t14-,18-/m0/s1 |
| InChIKey | HPZDFUSILUFZFL-KSSFIOAISA-O |
| XLogP | 2.85 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |