C14H17N2O2+ — CID 8755615
[(2R)-1-amino-1-oxopropan-2-yl]-[(R)-furan-2-yl(phenyl)methyl]azanium (PubChem CID 8755615) has the molecular formula C14H17N2O2+ and a molecular weight of 245.30 g/mol. Its IUPAC name is [(2R)-1-amino-1-oxopropan-2-yl]-[(R)-furan-2-yl(phenyl)methyl]azanium.
| Compound Name | [(2R)-1-amino-1-oxopropan-2-yl]-[(R)-furan-2-yl(phenyl)methyl]azanium |
|---|---|
| PubChem CID | 8755615 |
| Molecular Formula | C14H17N2O2+ |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | [(2R)-1-amino-1-oxopropan-2-yl]-[(R)-furan-2-yl(phenyl)methyl]azanium |
| SMILES | C[C@@H]([NH2+][C@H](c1ccccc1)c1ccco1)C(N)=O |
| InChI | InChI=1S/C14H16N2O2/c1-10(14(15)17)16-13(12-8-5-9-18-12)11-6-3-2-4-7-11/h2-10,13,16H,1H3,(H2,15,17)/p+1/t10-,13-/m1/s1 |
| InChIKey | JQECCGHVUAXIKF-ZWNOBZJWSA-O |
| XLogP | 0.81 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |