C20H20FN2O2+ — CID 8755189
[(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl]-[(S)-furan-2-yl(phenyl)methyl]azanium (PubChem CID 8755189) has the molecular formula C20H20FN2O2+ and a molecular weight of 339.39 g/mol. Its IUPAC name is [(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl]-[(S)-furan-2-yl(phenyl)methyl]azanium.
| Compound Name | [(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl]-[(S)-furan-2-yl(phenyl)methyl]azanium |
|---|---|
| PubChem CID | 8755189 |
| Molecular Formula | C20H20FN2O2+ |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | [(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl]-[(S)-furan-2-yl(phenyl)methyl]azanium |
| SMILES | C[C@@H]([NH2+][C@@H](c1ccccc1)c1ccco1)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C20H19FN2O2/c1-14(20(24)23-17-11-6-5-10-16(17)21)22-19(18-12-7-13-25-18)15-8-3-2-4-9-15/h2-14,19,22H,1H3,(H,23,24)/p+1/t14-,19+/m1/s1 |
| InChIKey | ZLRBVJKWKGJGAH-KUHUBIRLSA-O |
| XLogP | 3.10 |
| TPSA | 58.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |