C16H19N2O4+ — CID 8756395
[(S)-furan-2-yl(phenyl)methyl]-[(2S)-1-(methoxycarbonylamino)-1-oxopropan-2-yl]azanium (PubChem CID 8756395) has the molecular formula C16H19N2O4+ and a molecular weight of 303.34 g/mol. Its IUPAC name is [(S)-furan-2-yl(phenyl)methyl]-[(2S)-1-(methoxycarbonylamino)-1-oxopropan-2-yl]azanium.
| Compound Name | [(S)-furan-2-yl(phenyl)methyl]-[(2S)-1-(methoxycarbonylamino)-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 8756395 |
| Molecular Formula | C16H19N2O4+ |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | [(S)-furan-2-yl(phenyl)methyl]-[(2S)-1-(methoxycarbonylamino)-1-oxopropan-2-yl]azanium |
| SMILES | COC(=O)NC(=O)[C@H](C)[NH2+][C@@H](c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C16H18N2O4/c1-11(15(19)18-16(20)21-2)17-14(13-9-6-10-22-13)12-7-4-3-5-8-12/h3-11,14,17H,1-2H3,(H,18,19,20)/p+1/t11-,14-/m0/s1 |
| InChIKey | SNOZCTRGEKCXNQ-FZMZJTMJSA-O |
| XLogP | 1.20 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |