C22H24N3O3+ — CID 8696221
[(2R)-1-(4-acetamidoanilino)-1-oxopropan-2-yl]-[(R)-furan-2-yl(phenyl)methyl]azanium (PubChem CID 8696221) has the molecular formula C22H24N3O3+ and a molecular weight of 378.45 g/mol. Its IUPAC name is [(2R)-1-(4-acetamidoanilino)-1-oxopropan-2-yl]-[(R)-furan-2-yl(phenyl)methyl]azanium.
| Compound Name | [(2R)-1-(4-acetamidoanilino)-1-oxopropan-2-yl]-[(R)-furan-2-yl(phenyl)methyl]azanium |
|---|---|
| PubChem CID | 8696221 |
| Molecular Formula | C22H24N3O3+ |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | [(2R)-1-(4-acetamidoanilino)-1-oxopropan-2-yl]-[(R)-furan-2-yl(phenyl)methyl]azanium |
| SMILES | CC(=O)Nc1ccc(NC(=O)[C@@H](C)[NH2+][C@H](c2ccccc2)c2ccco2)cc1 |
| InChI | InChI=1S/C22H23N3O3/c1-15(22(27)25-19-12-10-18(11-13-19)24-16(2)26)23-21(20-9-6-14-28-20)17-7-4-3-5-8-17/h3-15,21,23H,1-2H3,(H,24,26)(H,25,27)/p+1/t15-,21-/m1/s1 |
| InChIKey | MTZCKQCZKPMVGF-QVKFZJNVSA-O |
| XLogP | 2.92 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |