C23H21N2O4+ — CID 8920161
[(2S)-1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl]-[(1S)-1-(furan-2-yl)ethyl]azanium (PubChem CID 8920161) has the molecular formula C23H21N2O4+ and a molecular weight of 389.43 g/mol. Its IUPAC name is [(2S)-1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl]-[(1S)-1-(furan-2-yl)ethyl]azanium.
| Compound Name | [(2S)-1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl]-[(1S)-1-(furan-2-yl)ethyl]azanium |
|---|---|
| PubChem CID | 8920161 |
| Molecular Formula | C23H21N2O4+ |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | [(2S)-1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl]-[(1S)-1-(furan-2-yl)ethyl]azanium |
| SMILES | C[C@H]([NH2+][C@@H](C)c1ccco1)C(=O)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H20N2O4/c1-13(20-8-5-11-29-20)24-14(2)23(28)25-15-9-10-18-19(12-15)22(27)17-7-4-3-6-16(17)21(18)26/h3-14,24H,1-2H3,(H,25,28)/p+1/t13-,14-/m0/s1 |
| InChIKey | UVQKGVRMDNUBSX-KBPBESRZSA-O |
| XLogP | 2.71 |
| TPSA | 92.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|