C23H20N2O4 — CID 8920166
(2S)-N-(9,10-dioxoanthracen-2-yl)-2-[[(1R)-1-(furan-2-yl)ethyl]amino]propanamide (PubChem CID 8920166) has the molecular formula C23H20N2O4 and a molecular weight of 388.42 g/mol. Its IUPAC name is (2S)-N-(9,10-dioxoanthracen-2-yl)-2-[[(1R)-1-(furan-2-yl)ethyl]amino]propanamide.
| Compound Name | (2S)-N-(9,10-dioxoanthracen-2-yl)-2-[[(1R)-1-(furan-2-yl)ethyl]amino]propanamide |
|---|---|
| PubChem CID | 8920166 |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | (2S)-N-(9,10-dioxoanthracen-2-yl)-2-[[(1R)-1-(furan-2-yl)ethyl]amino]propanamide |
| SMILES | C[C@H](N[C@H](C)c1ccco1)C(=O)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H20N2O4/c1-13(20-8-5-11-29-20)24-14(2)23(28)25-15-9-10-18-19(12-15)22(27)17-7-4-3-6-16(17)21(18)26/h3-14,24H,1-2H3,(H,25,28)/t13-,14+/m1/s1 |
| InChIKey | UVQKGVRMDNUBSX-KGLIPLIRSA-N |
| XLogP | 3.73 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|