C22H24N2O4 — CID 146097164
N-(9,10-dioxoanthracen-2-yl)-2-[[(2S,3S)-3-methoxybutan-2-yl]amino]propanamide (PubChem CID 146097164) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-2-yl)-2-[[(2S,3S)-3-methoxybutan-2-yl]amino]propanamide.
| Compound Name | N-(9,10-dioxoanthracen-2-yl)-2-[[(2S,3S)-3-methoxybutan-2-yl]amino]propanamide |
|---|---|
| PubChem CID | 146097164 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N-(9,10-dioxoanthracen-2-yl)-2-[[(2S,3S)-3-methoxybutan-2-yl]amino]propanamide |
| SMILES | CO[C@@H](C)[C@H](C)NC(C)C(=O)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H24N2O4/c1-12(14(3)28-4)23-13(2)22(27)24-15-9-10-18-19(11-15)21(26)17-8-6-5-7-16(17)20(18)25/h5-14,23H,1-4H3,(H,24,27)/t12-,13?,14-/m0/s1 |
| InChIKey | OSOMUIGGRXSHOB-HPNRGHHYSA-N |
| XLogP | 2.80 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|