C23H16ClFN2O3 — CID 26057005
(2S)-2-(3-chloro-4-fluoroanilino)-N-(9,10-dioxoanthracen-2-yl)propanamide (PubChem CID 26057005) has the molecular formula C23H16ClFN2O3 and a molecular weight of 422.84 g/mol. Its IUPAC name is (2S)-2-(3-chloro-4-fluoroanilino)-N-(9,10-dioxoanthracen-2-yl)propanamide.
| Compound Name | (2S)-2-(3-chloro-4-fluoroanilino)-N-(9,10-dioxoanthracen-2-yl)propanamide |
|---|---|
| PubChem CID | 26057005 |
| Molecular Formula | C23H16ClFN2O3 |
| Molecular Weight | 422.84 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | (2S)-2-(3-chloro-4-fluoroanilino)-N-(9,10-dioxoanthracen-2-yl)propanamide |
| SMILES | C[C@H](Nc1ccc(F)c(Cl)c1)C(=O)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H16ClFN2O3/c1-12(26-14-7-9-20(25)19(24)11-14)23(30)27-13-6-8-17-18(10-13)22(29)16-5-3-2-4-15(16)21(17)28/h2-12,26H,1H3,(H,27,30)/t12-/m0/s1 |
| InChIKey | CGGJOIVVLCAGCW-LBPRGKRZSA-N |
| XLogP | 4.69 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.84 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|