C15H13ClF2N2O3S — CID 1263361
(2R)-N-(3-chloro-4-fluorophenyl)-2-[(4-fluorophenyl)sulfonylamino]propanamide (PubChem CID 1263361) has the molecular formula C15H13ClF2N2O3S and a molecular weight of 374.80 g/mol. Its IUPAC name is (2R)-N-(3-chloro-4-fluorophenyl)-2-[(4-fluorophenyl)sulfonylamino]propanamide.
| Compound Name | (2R)-N-(3-chloro-4-fluorophenyl)-2-[(4-fluorophenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 1263361 |
| Molecular Formula | C15H13ClF2N2O3S |
| Molecular Weight | 374.80 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | (2R)-N-(3-chloro-4-fluorophenyl)-2-[(4-fluorophenyl)sulfonylamino]propanamide |
| SMILES | C[C@@H](NS(=O)(=O)c1ccc(F)cc1)C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H13ClF2N2O3S/c1-9(15(21)19-11-4-7-14(18)13(16)8-11)20-24(22,23)12-5-2-10(17)3-6-12/h2-9,20H,1H3,(H,19,21)/t9-/m1/s1 |
| InChIKey | CCXVTTKVEZERRO-SECBINFHSA-N |
| XLogP | 2.92 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.80 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |