C15H16FN3O5S2 — CID 124549106
(2R)-2-[(4-fluorophenyl)sulfonylamino]-N-(4-sulfamoylphenyl)propanamide (PubChem CID 124549106) has the molecular formula C15H16FN3O5S2 and a molecular weight of 401.44 g/mol. Its IUPAC name is (2R)-2-[(4-fluorophenyl)sulfonylamino]-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | (2R)-2-[(4-fluorophenyl)sulfonylamino]-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 124549106 |
| Molecular Formula | C15H16FN3O5S2 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | (2R)-2-[(4-fluorophenyl)sulfonylamino]-N-(4-sulfamoylphenyl)propanamide |
| SMILES | C[C@@H](NS(=O)(=O)c1ccc(F)cc1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H16FN3O5S2/c1-10(19-26(23,24)14-6-2-11(16)3-7-14)15(20)18-12-4-8-13(9-5-12)25(17,21)22/h2-10,19H,1H3,(H,18,20)(H2,17,21,22)/t10-/m1/s1 |
| InChIKey | PTXMWKWYTFSODY-SNVBAGLBSA-N |
| XLogP | 0.78 |
| TPSA | 135.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |