C9H13N3O5S2 — CID 94501214
(2S)-2-[(4-sulfamoylphenyl)sulfonylamino]propanamide (PubChem CID 94501214) has the molecular formula C9H13N3O5S2 and a molecular weight of 307.35 g/mol. Its IUPAC name is (2S)-2-[(4-sulfamoylphenyl)sulfonylamino]propanamide.
| Compound Name | (2S)-2-[(4-sulfamoylphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 94501214 |
| Molecular Formula | C9H13N3O5S2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | (2S)-2-[(4-sulfamoylphenyl)sulfonylamino]propanamide |
| SMILES | C[C@H](NS(=O)(=O)c1ccc(S(N)(=O)=O)cc1)C(N)=O |
| InChI | InChI=1S/C9H13N3O5S2/c1-6(9(10)13)12-19(16,17)8-4-2-7(3-5-8)18(11,14)15/h2-6,12H,1H3,(H2,10,13)(H2,11,14,15)/t6-/m0/s1 |
| InChIKey | ZIJBSOFPNYACBB-LURJTMIESA-N |
| XLogP | -1.51 |
| TPSA | 149.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |