C10H10FN3O3S — CID 63239306
2-[(3-cyano-4-fluorophenyl)sulfonylamino]propanamide (PubChem CID 63239306) has the molecular formula C10H10FN3O3S and a molecular weight of 271.27 g/mol. Its IUPAC name is 2-[(3-cyano-4-fluorophenyl)sulfonylamino]propanamide.
| Compound Name | 2-[(3-cyano-4-fluorophenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 63239306 |
| Molecular Formula | C10H10FN3O3S |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 2-[(3-cyano-4-fluorophenyl)sulfonylamino]propanamide |
| SMILES | CC(NS(=O)(=O)c1ccc(F)c(C#N)c1)C(N)=O |
| InChI | InChI=1S/C10H10FN3O3S/c1-6(10(13)15)14-18(16,17)8-2-3-9(11)7(4-8)5-12/h2-4,6,14H,1H3,(H2,13,15) |
| InChIKey | UXUFUADLXXDBTN-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |