C11H10F4N2O2S — CID 104854815
3-cyano-4-fluoro-N-(4,4,4-trifluorobutan-2-yl)benzenesulfonamide (PubChem CID 104854815) has the molecular formula C11H10F4N2O2S and a molecular weight of 310.27 g/mol. Its IUPAC name is 3-cyano-4-fluoro-N-(4,4,4-trifluorobutan-2-yl)benzenesulfonamide.
| Compound Name | 3-cyano-4-fluoro-N-(4,4,4-trifluorobutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 104854815 |
| Molecular Formula | C11H10F4N2O2S |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 3-cyano-4-fluoro-N-(4,4,4-trifluorobutan-2-yl)benzenesulfonamide |
| SMILES | CC(CC(F)(F)F)NS(=O)(=O)c1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C11H10F4N2O2S/c1-7(5-11(13,14)15)17-20(18,19)9-2-3-10(12)8(4-9)6-16/h2-4,7,17H,5H2,1H3 |
| InChIKey | SOVIHPXJIGPIAC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |