C10H13F3N2O4S2 — CID 104854834
4-N-(4,4,4-trifluorobutan-2-yl)benzene-1,4-disulfonamide (PubChem CID 104854834) has the molecular formula C10H13F3N2O4S2 and a molecular weight of 346.35 g/mol. Its IUPAC name is 4-N-(4,4,4-trifluorobutan-2-yl)benzene-1,4-disulfonamide.
| Compound Name | 4-N-(4,4,4-trifluorobutan-2-yl)benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 104854834 |
| Molecular Formula | C10H13F3N2O4S2 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 4-N-(4,4,4-trifluorobutan-2-yl)benzene-1,4-disulfonamide |
| SMILES | CC(CC(F)(F)F)NS(=O)(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C10H13F3N2O4S2/c1-7(6-10(11,12)13)15-21(18,19)9-4-2-8(3-5-9)20(14,16)17/h2-5,7,15H,6H2,1H3,(H2,14,16,17) |
| InChIKey | IFWNCJVHVKTGLD-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |