C10H10BrF3N2O4S — CID 104854791
5-bromo-2-nitro-N-(4,4,4-trifluorobutan-2-yl)benzenesulfonamide (PubChem CID 104854791) has the molecular formula C10H10BrF3N2O4S and a molecular weight of 391.17 g/mol. Its IUPAC name is 5-bromo-2-nitro-N-(4,4,4-trifluorobutan-2-yl)benzenesulfonamide.
| Compound Name | 5-bromo-2-nitro-N-(4,4,4-trifluorobutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 104854791 |
| Molecular Formula | C10H10BrF3N2O4S |
| Molecular Weight | 391.17 g/mol |
| Exact Mass | 389.95 |
| IUPAC Name | 5-bromo-2-nitro-N-(4,4,4-trifluorobutan-2-yl)benzenesulfonamide |
| SMILES | CC(CC(F)(F)F)NS(=O)(=O)c1cc(Br)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10BrF3N2O4S/c1-6(5-10(12,13)14)15-21(19,20)9-4-7(11)2-3-8(9)16(17)18/h2-4,6,15H,5H2,1H3 |
| InChIKey | WYXNABYHQFTPOW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.17 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|