C11H15BrN2O4S2 — CID 115638852
5-bromo-N-(4-methylsulfanylbutan-2-yl)-2-nitrobenzenesulfonamide (PubChem CID 115638852) has the molecular formula C11H15BrN2O4S2 and a molecular weight of 383.29 g/mol. Its IUPAC name is 5-bromo-N-(4-methylsulfanylbutan-2-yl)-2-nitrobenzenesulfonamide.
| Compound Name | 5-bromo-N-(4-methylsulfanylbutan-2-yl)-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 115638852 |
| Molecular Formula | C11H15BrN2O4S2 |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 381.97 |
| IUPAC Name | 5-bromo-N-(4-methylsulfanylbutan-2-yl)-2-nitrobenzenesulfonamide |
| SMILES | CSCCC(C)NS(=O)(=O)c1cc(Br)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H15BrN2O4S2/c1-8(5-6-19-2)13-20(17,18)11-7-9(12)3-4-10(11)14(15)16/h3-4,7-8,13H,5-6H2,1-2H3 |
| InChIKey | ZNLHGAFHGQBUQS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|