C12H19BrN2O2S2 — CID 114380197
3-amino-5-bromo-2-methyl-N-(4-methylsulfanylbutan-2-yl)benzenesulfonamide (PubChem CID 114380197) has the molecular formula C12H19BrN2O2S2 and a molecular weight of 367.33 g/mol. Its IUPAC name is 3-amino-5-bromo-2-methyl-N-(4-methylsulfanylbutan-2-yl)benzenesulfonamide.
| Compound Name | 3-amino-5-bromo-2-methyl-N-(4-methylsulfanylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 114380197 |
| Molecular Formula | C12H19BrN2O2S2 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | 3-amino-5-bromo-2-methyl-N-(4-methylsulfanylbutan-2-yl)benzenesulfonamide |
| SMILES | CSCCC(C)NS(=O)(=O)c1cc(Br)cc(N)c1C |
| InChI | InChI=1S/C12H19BrN2O2S2/c1-8(4-5-18-3)15-19(16,17)12-7-10(13)6-11(14)9(12)2/h6-8,15H,4-5,14H2,1-3H3 |
| InChIKey | JJNVPBTVDQLVFB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|