C11H17BrN2O3S2 — CID 114380223
3-amino-5-bromo-2-methyl-N-(1-methylsulfinylpropan-2-yl)benzenesulfonamide (PubChem CID 114380223) has the molecular formula C11H17BrN2O3S2 and a molecular weight of 369.31 g/mol. Its IUPAC name is 3-amino-5-bromo-2-methyl-N-(1-methylsulfinylpropan-2-yl)benzenesulfonamide.
| Compound Name | 3-amino-5-bromo-2-methyl-N-(1-methylsulfinylpropan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 114380223 |
| Molecular Formula | C11H17BrN2O3S2 |
| Molecular Weight | 369.31 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | 3-amino-5-bromo-2-methyl-N-(1-methylsulfinylpropan-2-yl)benzenesulfonamide |
| SMILES | Cc1c(N)cc(Br)cc1S(=O)(=O)NC(C)CS(C)=O |
| InChI | InChI=1S/C11H17BrN2O3S2/c1-7(6-18(3)15)14-19(16,17)11-5-9(12)4-10(13)8(11)2/h4-5,7,14H,6,13H2,1-3H3 |
| InChIKey | VDMUBDGFIOEPKL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|